Difference between revisions of "CPD-10488"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN 4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN] == * direction: ** LEFT-TO-R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N |
| + | * common name: | ||
| + | ** N-formyl-D-kynurenine | ||
| + | * molecular weight: | ||
| + | ** 236.227 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8664]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605] |
| − | {{#set: | + | * HMDB : HMDB01200 |
| − | {{#set: | + | {{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}} |
| − | + | {{#set: common name=N-formyl-D-kynurenine}} | |
| + | {{#set: molecular weight=236.227 }} | ||
| + | {{#set: produced by=RXN-8664}} | ||
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-10488
- smiles:
- C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
- common name:
- N-formyl-D-kynurenine
- molecular weight:
- 236.227
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)" cannot be used as a page name in this wiki.
