Difference between revisions of "CPD-308"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE--TRNA-LIGASE-RXN THREONINE--TRNA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** D-nopaline |
− | * | + | * molecular weight: |
− | ** | + | ** 303.294 |
* Synonym(s): | * Synonym(s): | ||
+ | ** N2-(D-1,3-dicarboxypropyl)-L-arginine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.5.1.19-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682] | |
− | + | {{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}} | |
− | * | + | {{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}} |
− | ** [http://www. | + | {{#set: common name=D-nopaline}} |
− | + | {{#set: molecular weight=303.294 }} | |
− | + | {{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}} | |
− | + | {{#set: produced by=1.5.1.19-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-308
- smiles:
- C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
- inchi key:
- InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
- common name:
- D-nopaline
- molecular weight:
- 303.294
- Synonym(s):
- N2-(D-1,3-dicarboxypropyl)-L-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.