Difference between revisions of "RXN-12521"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD(P)-binding domain |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[1 | + | ** 1 [[NADPH]][c] '''+''' 1 [[TETRADEHYDROACYL-COA]][c] '''=>''' 1 [[Trans-3-enoyl-CoAs]][c] '''+''' 1 [[NADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NADPH[c] '''+''' 1 a trans-2,trans-4-dienoyl-CoA[c] '''=>''' 1 a trans-3-enoyl-CoA[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_003950]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=NAD(P)-binding domain}} | |
− | + | {{#set: ec number=EC-1.3.1.34}} | |
− | + | {{#set: gene associated=Ec-16_003950}} | |
− | + | {{#set: in pathway=PWY-6837}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN-12521
- direction:
- LEFT-TO-RIGHT
- common name:
- NAD(P)-binding domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 TETRADEHYDROACYL-COA[c] => 1 Trans-3-enoyl-CoAs[c] + 1 NADP[c]
- With common name(s):
- 1 NADPH[c] + 1 a trans-2,trans-4-dienoyl-CoA[c] => 1 a trans-3-enoyl-CoA[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_003950
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6837, fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): PWY-6837
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome