Difference between revisions of "CPD-16475"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == * smiles: ** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N |
* common name: | * common name: | ||
− | ** | + | ** β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 529.494 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine |
+ | ** Lewis x epitope | ||
+ | ** Lex epitope | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15268]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11813424 11813424] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62287 62287] |
− | {{#set: common name= | + | {{#set: smiles=CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N}} |
− | {{#set: common name= | + | {{#set: common name=β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine}} |
− | {{#set: | + | {{#set: molecular weight=529.494 }} |
+ | {{#set: common name=β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine|Lewis x epitope|Lex epitope}} | ||
+ | {{#set: reversible reaction associated=RXN-15268}} |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPD-16475
- smiles:
- CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)
- inchi key:
- InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N
- common name:
- β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine
- molecular weight:
- 529.494
- Synonym(s):
- β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine
- Lewis x epitope
- Lex epitope
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine" cannot be used as a page name in this wiki.
"β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine" cannot be used as a page name in this wiki.