Difference between revisions of "Ec-01 003500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == * smiles: ** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)...")
 
(Created page with "Category:Gene == Gene Ec-01_003500 == * left end position: ** 2963967 * transcription direction: ** POSITIVE * right end position: ** 2965610 * centisome position: ** 28.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] ==
+
== Gene Ec-01_003500 ==
* smiles:
+
* left end position:
** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)
+
** 2963967
* inchi key:
+
* transcription direction:
** InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N
+
** POSITIVE
* common name:
+
* right end position:
** β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine
+
** 2965610
* molecular weight:
+
* centisome position:
** 529.494    
+
** 28.723856    
 
* Synonym(s):
 
* Synonym(s):
** β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine
+
** Esi_0003_0266
** Lewis x epitope
+
** Esi0003_0266
** Lex epitope
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PRTRANS-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-15268]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2963967}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11813424 11813424]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=2965610}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62287 62287]
+
{{#set: centisome position=28.723856   }}
{{#set: smiles=CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)}}
+
{{#set: common name=Esi_0003_0266|Esi0003_0266}}
{{#set: inchi key=InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N}}
+
{{#set: reaction associated=PRTRANS-RXN}}
{{#set: common name=β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine}}
+
{{#set: pathway associated=TRPSYN-PWY}}
{{#set: molecular weight=529.494   }}
+
{{#set: common name=β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine|Lewis x epitope|Lex epitope}}
+
{{#set: consumed or produced by=RXN-15268}}
+

Latest revision as of 19:48, 21 March 2018

Gene Ec-01_003500

  • left end position:
    • 2963967
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2965610
  • centisome position:
    • 28.723856
  • Synonym(s):
    • Esi_0003_0266
    • Esi0003_0266

Reactions associated

Pathways associated

External links