Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-55962 TAX-5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-55962 TAX-55962]
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
 +
* inchi key:
 +
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
 
* common name:
 
* common name:
** hyperforin and adhyperforin biosynthesis
+
** shikimate 3-phosphate
 +
* molecular weight:
 +
** 251.109   
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimate 5-phosphate
 +
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN-7813]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [[2.5.1.19-RXN]]
* '''5''' reaction(s) not found
+
* [[SHIKIMATE-KINASE-RXN]]
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7805 RXN-7805]
+
** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.156-RXN 2.3.1.156-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7812 RXN-7812]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13549 RXN-13549]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9135 RXN-9135]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-55962}}
+
* PUBCHEM:
{{#set: common name=hyperforin and adhyperforin biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
{{#set: reaction found=1}}
+
* CHEBI:
{{#set: reaction not found=5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
 +
* BIGG : 41343
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
 +
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
 +
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
 +
{{#set: common name=shikimate 3-phosphate}}
 +
{{#set: molecular weight=251.109    }}
 +
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
 +
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}

Latest revision as of 19:03, 21 March 2018

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • common name:
    • shikimate 3-phosphate
  • molecular weight:
    • 251.109
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.