Difference between revisions of "Ec-12 001420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Gene == Gene Ec-12_001420 == * left end position: ** 1410815 * transcription direction: ** NEGATIVE * right end position: ** 1416248 * centisome position: ** 16.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Gene Ec-12_001420 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1410815
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
** 1416248
−
* molecular weight:
+
* centisome position:
−
** 1013.883    
+
** 16.92426    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ7-CoA
+
** Esi_0087_0036
−
** 3-oxo-7-cis-hexadecenoyl-CoA
+
** Esi0087_0036
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-13908]]
−
* [[RXN-17781]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN-7908]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PHENYLALANINE-DEG1-PWY]]
 +
* [[PWY-7158]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=1410815}}
−
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=1416248}}
−
{{#set: molecular weight=1013.883   }}
+
{{#set: centisome position=16.92426   }}
−
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0087_0036|Esi0087_0036}}
−
{{#set: produced by=RXN-17781}}
+
{{#set: reaction associated=RXN-13908|RXN-7908}}
 +
{{#set: pathway associated=PHENYLALANINE-DEG1-PWY|PWY-7158}}

Latest revision as of 19:48, 21 March 2018

Gene Ec-12_001420

  • left end position:
    • 1410815
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1416248
  • centisome position:
    • 16.92426
  • Synonym(s):
    • Esi_0087_0036
    • Esi0087_0036

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_001420&oldid=29452"