Difference between revisions of "Ec-21 001090"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-21_001090 == * left end position: ** 1946897 * transcription direction: ** POSITIVE * right end position: ** 1953478 * centisome position: ** 26.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_001090 == |
− | * | + | * left end position: |
− | ** | + | ** 1946897 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1953478 |
− | * | + | * centisome position: |
− | ** | + | ** 26.380291 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0025_0065 |
− | ** | + | ** Esi0025_0065 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-7253]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-5408]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4702]] | ||
+ | * [[PWY-2301]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1946897}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1953478}} | |
− | + | {{#set: centisome position=26.380291 }} | |
− | + | {{#set: common name=Esi_0025_0065|Esi0025_0065}} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN-7253|RXN0-5408}} | |
− | + | {{#set: pathway associated=PWY-4702|PWY-2301}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:48, 21 March 2018
Gene Ec-21_001090
- left end position:
- 1946897
- transcription direction:
- POSITIVE
- right end position:
- 1953478
- centisome position:
- 26.380291
- Synonym(s):
- Esi_0025_0065
- Esi0025_0065
Reactions associated
- Reaction: MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7253
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5408
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome