Difference between revisions of "PANTOTHENATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_001090 == * left end position: ** 1946897 * transcription direction: ** POSITIVE * right end position: ** 1953478 * centisome position: ** 26.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M |
| − | * | + | * common name: |
| − | ** | + | ** (R)-pantothenate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 218.229 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin B5 |
| − | ** | + | ** (R)-pantothenic acid |
| + | ** D-pantothenic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PANTOTHENATE-KIN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 79-83-4 |
| − | {{#set: | + | * Wikipedia : Vitamin_B5 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167945 167945] |
| − | {{#set: common name= | + | * HMDB : HMDB00210 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00864 C00864] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.146912.html 146912] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29032 29032] | ||
| + | * BIGG : 36234 | ||
| + | {{#set: smiles=CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M}} | ||
| + | {{#set: common name=(R)-pantothenate}} | ||
| + | {{#set: molecular weight=218.229 }} | ||
| + | {{#set: common name=vitamin B5|(R)-pantothenic acid|D-pantothenic acid}} | ||
| + | {{#set: consumed by=PANTOTHENATE-KIN-RXN}} | ||
| + | {{#set: produced by=PANTOATE-BETA-ALANINE-LIG-RXN}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite PANTOTHENATE
- smiles:
- CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]
- inchi key:
- InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M
- common name:
- (R)-pantothenate
- molecular weight:
- 218.229
- Synonym(s):
- vitamin B5
- (R)-pantothenic acid
- D-pantothenic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 79-83-4
- Wikipedia : Vitamin_B5
- PUBCHEM:
- HMDB : HMDB00210
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 36234
"CC(C)(CO)C(O)C(=O)NCCC(=O)[O-" cannot be used as a page name in this wiki.
