Difference between revisions of "CPD-1828"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K |
* common name: | * common name: | ||
| − | ** α-D- | + | ** GDP-α-D-mannuronate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 616.305 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** GDP-mannuronic acid |
| − | ** | + | ** GDP-α-D-mannuronic acid |
| − | ** | + | ** GDP-mannuronate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966153 11966153] |
| − | * | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.10140147.html 10140147] | |
| − | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17466 17466] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C(O) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00976 C00976] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))}} |
| − | {{#set: common name=α-D- | + | {{#set: inchi key=InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K}} |
| − | {{#set: molecular weight= | + | {{#set: common name=GDP-α-D-mannuronate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=616.305 }} |
| − | {{#set: | + | {{#set: common name=GDP-mannuronic acid|GDP-α-D-mannuronic acid|GDP-mannuronate}} |
| − | + | {{#set: produced by=GDP-MANNOSE-6-DEHYDROGENASE-RXN}} | |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPD-1828
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))
- inchi key:
- InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K
- common name:
- GDP-α-D-mannuronate
- molecular weight:
- 616.305
- Synonym(s):
- GDP-mannuronic acid
- GDP-α-D-mannuronic acid
- GDP-mannuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))" cannot be used as a page name in this wiki.
