Difference between revisions of "3-KETOLACTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1281 RXN0-1281] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrouridine synthase **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1281 RXN0-1281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
 +
* inchi key:
 +
** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
 
* common name:
 
* common name:
−
** dihydrouridine synthase
+
** 3'-ketolactose
−
** tRNA-dihydrouridine synthase
+
* molecular weight:
−
** FAD binding / catalytic/ tRNA dihydrouridine synthase
+
** 340.283   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[KETOLACTOSE-RXN]]
−
** 1 [[tRNA-uridines]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[tRNA-Dihydrouridines]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a uridine in tRNA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 a 5,6-dihydrouridine in tRNA[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_010520]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-18_002590]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-01_000230]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=dihydrouridine synthase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571]
−
{{#set: common name=tRNA-dihydrouridine synthase}}
+
* KEGG-GLYCAN : G10531
−
{{#set: common name=FAD binding / catalytic/ tRNA dihydrouridine synthase}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.1.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403]
−
{{#set: gene associated=Ec-01_010520|Ec-18_002590|Ec-01_000230}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB01030
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}}
 +
{{#set: common name=3'-ketolactose}}
 +
{{#set: molecular weight=340.283    }}
 +
{{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}}
 +
{{#set: consumed by=KETOLACTOSE-RXN}}

Latest revision as of 19:49, 21 March 2018

Metabolite 3-KETOLACTOSE

  • smiles:
    • C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
  • inchi key:
    • InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
  • common name:
    • 3'-ketolactose
  • molecular weight:
    • 340.283
  • Synonym(s):
    • 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-KETOLACTOSE&oldid=29508"