Difference between revisions of "DPG"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_002790 == * left end position: ** 2900134 * transcription direction: ** POSITIVE * right end position: ** 2903510 * centisome position: ** 44.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J |
− | * | + | * common name: |
− | ** | + | ** 1,3-bisphospho-D-glycerate |
− | * | + | * molecular weight: |
− | ** | + | ** 262.006 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-phospho-D-glyceroyl-phosphate |
− | ** | + | ** 3-phosphoglyceroyl-P |
+ | ** P-glyceroyl-P | ||
+ | ** phosphoglyceroyl-P | ||
+ | ** 3-phosphoglyceroyl-phosphate | ||
+ | ** 3-P-glyceroyl-P | ||
+ | ** DPG | ||
+ | ** 13-DPG | ||
+ | ** glycerate 1,3-bisphosphate | ||
+ | ** 3-phosphonato-D-glyceroyl phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.2.1.13-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GAPOXNPHOSPHN-RXN]] | |
− | + | * [[PHOSGLYPHOS-RXN]] | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1981-49-3 |
− | {{#set: | + | * BIGG : 34342 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878409 46878409] |
− | {{#set: common name= | + | * HMDB : HMDB01270 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00236 C00236] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19698372.html 19698372] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57604 57604] | ||
+ | * METABOLIGHTS : MTBLC57604 | ||
+ | {{#set: smiles=C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J}} | ||
+ | {{#set: common name=1,3-bisphospho-D-glycerate}} | ||
+ | {{#set: molecular weight=262.006 }} | ||
+ | {{#set: common name=3-phospho-D-glyceroyl-phosphate|3-phosphoglyceroyl-P|P-glyceroyl-P|phosphoglyceroyl-P|3-phosphoglyceroyl-phosphate|3-P-glyceroyl-P|DPG|13-DPG|glycerate 1,3-bisphosphate|3-phosphonato-D-glyceroyl phosphate}} | ||
+ | {{#set: consumed by=1.2.1.13-RXN}} | ||
+ | {{#set: reversible reaction associated=GAPOXNPHOSPHN-RXN|PHOSGLYPHOS-RXN}} |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite DPG
- smiles:
- C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]
- inchi key:
- InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J
- common name:
- 1,3-bisphospho-D-glycerate
- molecular weight:
- 262.006
- Synonym(s):
- 3-phospho-D-glyceroyl-phosphate
- 3-phosphoglyceroyl-P
- P-glyceroyl-P
- phosphoglyceroyl-P
- 3-phosphoglyceroyl-phosphate
- 3-P-glyceroyl-P
- DPG
- 13-DPG
- glycerate 1,3-bisphosphate
- 3-phosphonato-D-glyceroyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1981-49-3
- BIGG : 34342
- PUBCHEM:
- HMDB : HMDB01270
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57604
"C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-" cannot be used as a page name in this wiki.