Difference between revisions of "Ec-15 002920"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-...")
 
(Created page with "Category:Gene == Gene Ec-15_002920 == * left end position: ** 3129065 * transcription direction: ** NEGATIVE * right end position: ** 3134392 * centisome position: ** 57.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] ==
+
== Gene Ec-15_002920 ==
−
* smiles:
+
* left end position:
−
** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
+
** 3129065
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** pseudouridine 5'-phosphate
+
** 3134392
−
* molecular weight:
+
* centisome position:
−
** 322.168    
+
** 57.9644    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0076_0061
 +
** Esi0076_0061
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AMACETOXID-RXN]]
−
* [[PSEUDOURIDINE-KINASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[RXN0-5398]]
+
** Source: [[orthology-aragem]]
 +
* Reaction: [[AMINEOXID-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[AMINEPHEN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-11784]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-5821]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-6381]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9597]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN6666-4]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7431]]
 +
* [[PWY-3981]]
 +
* [[THRDLCTCAT-PWY]]
 +
* [[PWY6666-2]]
 +
* [[2PHENDEG-PWY]]
 +
* [[PWY-6802]]
 +
* [[PWY-5751]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1157-60-4
+
{{#set: left end position=3129065}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232]
+
{{#set: right end position=3134392}}
−
* CHEBI:
+
{{#set: centisome position=57.9644    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380]
+
{{#set: common name=Esi_0076_0061|Esi0076_0061}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=AMACETOXID-RXN|AMINEOXID-RXN|AMINEPHEN-RXN|RXN-11784|RXN-5821|RXN-6381|RXN-9597|RXN6666-4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168]
+
{{#set: pathway associated=PWY-7431|PWY-3981|THRDLCTCAT-PWY|PWY6666-2|2PHENDEG-PWY|PWY-6802|PWY-5751}}
−
* HMDB : HMDB01271
+
−
{{#set: smiles=C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}}
+
−
{{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}}
+
−
{{#set: common name=pseudouridine 5'-phosphate}}
+
−
{{#set: molecular weight=322.168    }}
+
−
{{#set: produced by=PSEUDOURIDINE-KINASE-RXN}}
+
−
{{#set: consumed or produced by=RXN0-5398}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-15_002920

  • left end position:
    • 3129065
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3134392
  • centisome position:
    • 57.9644
  • Synonym(s):
    • Esi_0076_0061
    • Esi0076_0061

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_002920&oldid=29568"