Difference between revisions of "Ec-00 008870"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...")
 
(Created page with "Category:Gene == Gene Ec-00_008870 == * left end position: ** 14669060 * transcription direction: ** POSITIVE * right end position: ** 14674730 * centisome position: ** 77...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] ==
+
== Gene Ec-00_008870 ==
−
* smiles:
+
* left end position:
−
** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
+
** 14669060
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
+
** 14674730
−
* molecular weight:
+
* centisome position:
−
** 966.676    
+
** 77.42387    
 
* Synonym(s):
 
* Synonym(s):
−
** succinylbenzoyl-CoA
+
** Esi_0648_0003
−
** 2-succinylbenzoyl-CoA
+
** Esi0648_0003
−
** 2-(3'-carboxypropionyl)benzoyl-CoA
+
** GST
−
** o-succinylbenzoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[NAPHTHOATE-SYN-RXN]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=14669060}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=14674730}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509]
+
{{#set: centisome position=77.42387   }}
−
* BIGG : 41314
+
{{#set: common name=Esi_0648_0003|Esi0648_0003|GST}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160]
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}}
+
−
{{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}}
+
−
{{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}}
+
−
{{#set: molecular weight=966.676   }}
+
−
{{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}}
+
−
{{#set: consumed by=NAPHTHOATE-SYN-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-00_008870

  • left end position:
    • 14669060
  • transcription direction:
    • POSITIVE
  • right end position:
    • 14674730
  • centisome position:
    • 77.42387
  • Synonym(s):
    • Esi_0648_0003
    • Esi0648_0003
    • GST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008870&oldid=29580"