Difference between revisions of "CPD-725"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z-3-oxo-tetradec-5-enoyl-ACPs 5Z-3-oxo-tetradec-5-enoyl-ACPs] == * common name: ** a (5Z)-3-ox...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == |
| + | * smiles: | ||
| + | ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO | ||
| + | * inchi key: | ||
| + | ** InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 13(S)-HPOTE |
| + | * molecular weight: | ||
| + | ** 309.425 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 13(S)-hydroperoxylinolenic acid |
| − | ** | + | ** hydroperoxylinolenic acid |
| + | ** 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid | ||
| + | ** 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate | ||
| + | ** 13(S)-hydroperoxylinolenate | ||
| + | ** (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1321]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266757 45266757] |
| − | + | * CHEBI: | |
| − | {{#set: produced by=RXN- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58757 58757] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04785 C04785] | ||
| + | {{#set: smiles=CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO}} | ||
| + | {{#set: inchi key=InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M}} | ||
| + | {{#set: common name=13(S)-HPOTE}} | ||
| + | {{#set: molecular weight=309.425 }} | ||
| + | {{#set: common name=13(S)-hydroperoxylinolenic acid|hydroperoxylinolenic acid|13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid|13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate|13(S)-hydroperoxylinolenate|(9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate}} | ||
| + | {{#set: produced by=RXN-1321}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-725
- smiles:
- CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
- inchi key:
- InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
- common name:
- 13(S)-HPOTE
- molecular weight:
- 309.425
- Synonym(s):
- 13(S)-hydroperoxylinolenic acid
- hydroperoxylinolenic acid
- 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
- 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
- 13(S)-hydroperoxylinolenate
- (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.
