Difference between revisions of "Ec-12 004360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Gene == Gene Ec-12_004360 == * left end position: ** 4053633 * transcription direction: ** POSITIVE * right end position: ** 4057873 * centisome position: ** 48.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_004360 == |
− | * | + | * left end position: |
− | ** | + | ** 4053633 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4057873 |
− | * | + | * centisome position: |
− | ** | + | ** 48.62773 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0070_0110 |
+ | ** Esi0070_0110 | ||
+ | ** PK | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4053633}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4057873}} | |
− | + | {{#set: centisome position=48.62773 }} | |
− | + | {{#set: common name=Esi_0070_0110|Esi0070_0110|PK}} | |
− | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:49, 21 March 2018
Gene Ec-12_004360
- left end position:
- 4053633
- transcription direction:
- POSITIVE
- right end position:
- 4057873
- centisome position:
- 48.62773
- Synonym(s):
- Esi_0070_0110
- Esi0070_0110
- PK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome