Difference between revisions of "R163-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R163-RXN R163-RXN] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R163-RXN R163-RXN] ==
−
* smiles:
+
* direction:
−
** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
+
−
* common name:
+
−
** 13(S)-HPOTE
+
−
* molecular weight:
+
−
** 309.425   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 13(S)-hydroperoxylinolenic acid
 
−
** hydroperoxylinolenic acid
 
−
** 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
 
−
** 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
 
−
** 13(S)-hydroperoxylinolenate
 
−
** (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-1321]]
+
** 1 [[PAPS]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[APS]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 H2O[c] '''<=>''' 1 adenosine 5'-phosphosulfate[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006130]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266757 45266757]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00508 R00508]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58757 58757]
+
{{#set: gene associated=Ec-14_006130}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04785 C04785]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: inchi key=InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=13(S)-HPOTE}}
+
−
{{#set: molecular weight=309.425    }}
+
−
{{#set: common name=13(S)-hydroperoxylinolenic acid|hydroperoxylinolenic acid|13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid|13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate|13(S)-hydroperoxylinolenate|(9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate}}
+
−
{{#set: produced by=RXN-1321}}
+

Latest revision as of 19:49, 21 March 2018

Reaction R163-RXN

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3'-phosphoadenylyl-sulfate[c] + 1 H2O[c] <=> 1 adenosine 5'-phosphosulfate[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=R163-RXN&oldid=29603"