Difference between revisions of "Ec-03 002280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
 
(Created page with "Category:Gene == Gene Ec-03_002280 == * left end position: ** 2779795 * transcription direction: ** POSITIVE * right end position: ** 2785234 * centisome position: ** 42.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
+
== Gene Ec-03_002280 ==
* smiles:
+
* left end position:
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
+
** 2779795
* inchi key:
+
* transcription direction:
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
+
** POSITIVE
* common name:
+
* right end position:
** biotinyl-5'-adenylate
+
** 2785234
* molecular weight:
+
* centisome position:
** 572.509    
+
** 42.578335    
 
* Synonym(s):
 
* Synonym(s):
** biotinyl-5'-AMP
+
** Esi_0011_0091
 +
** Esi0011_0091
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.151-RXN]]
* [[RXN0-7192]]
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7434]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2779795}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=2785234}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
+
{{#set: centisome position=42.578335   }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0011_0091|Esi0011_0091}}
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
+
{{#set: reaction associated=2.4.1.151-RXN}}
* HMDB : HMDB04220
+
{{#set: pathway associated=PWY-7434}}
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
+
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
+
{{#set: common name=biotinyl-5'-adenylate}}
+
{{#set: molecular weight=572.509   }}
+
{{#set: common name=biotinyl-5'-AMP}}
+
{{#set: produced by=RXN0-7192}}
+

Latest revision as of 20:49, 21 March 2018

Gene Ec-03_002280

  • left end position:
    • 2779795
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2785234
  • centisome position:
    • 42.578335
  • Synonym(s):
    • Esi_0011_0091
    • Esi0011_0091

Reactions associated

Pathways associated

External links