Difference between revisions of "DETOX1-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TA...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
+
 
* common name:
 
* common name:
−
** β-D-glucose 6-phosphate
+
** superoxide radicals degradation
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-glucose-6-P
+
** removal of superoxide radicals
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-579]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[CATAL-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 9 associated gene(s):
 +
*** [[Ec-02_000470]]
 +
*** [[Ec-07_001420]]
 +
*** [[Ec-00_008210]]
 +
*** [[Ec-11_003410]]
 +
*** [[Ec-00_008230]]
 +
*** [[Ec-00_010030]]
 +
*** [[Ec-00_008240]]
 +
*** [[Ec-07_004600]]
 +
*** [[Ec-05_003380]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[SUPEROX-DISMUT-RXN]]
 +
** 8 associated gene(s):
 +
*** [[Ec-01_003850]]
 +
*** [[Ec-04_002870]]
 +
*** [[Ec-05_000630]]
 +
*** [[Ec-25_000220]]
 +
*** [[Ec-22_002450]]
 +
*** [[Ec-08_003590]]
 +
*** [[Ec-01_007760]]
 +
*** [[Ec-00_002760]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
−
* HMDB : HMDB03498
+
* ARACYC:
−
* LIGAND-CPD:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
−
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
+
{{#set: common name=superoxide radicals degradation}}
−
* CHEBI:
+
{{#set: common name=removal of superoxide radicals}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
+
{{#set: reaction found=2}}
−
* BIGG : 36977
+
{{#set: total reaction=2}}
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
+
−
{{#set: common name=β-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=β-D-glucose-6-P}}
+
−
{{#set: consumed by=RXN66-579}}
+

Latest revision as of 19:03, 21 March 2018

Pathway DETOX1-PWY

  • taxonomic range:
  • common name:
    • superoxide radicals degradation
  • Synonym(s):
    • removal of superoxide radicals

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DETOX1-PWY&oldid=24229"