Difference between revisions of "CPD1F-120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Succi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
 
* common name:
 
* common name:
−
** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
+
** gibberellin A24
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.4.3.16 EC-1.4.3.16]
+
** 344.407   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA24
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[L-ASPARTATE]][c] '''=>''' 1 [[IMINOASPARTATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
* [[RXN1F-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 L-aspartate[c] '''=>''' 1 2-iminosuccinate[c] '''+''' 1 H+[c] '''+''' 1 hydrogen peroxide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-05_003640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5316]], nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316]
+
−
** '''3''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7342]], superpathway of nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342]
+
−
** '''4''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25876 25876]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00481 R00481]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00357 R00357]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
−
{{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}}
+
* HMDB : HMDB37103
−
{{#set: ec number=EC-1.4.3.16}}
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
−
{{#set: gene associated=Ec-05_003640}}
+
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
−
{{#set: in pathway=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}}
+
{{#set: common name=gibberellin A24}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=344.407    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=GA24}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN1F-163}}

Latest revision as of 19:50, 21 March 2018

Metabolite CPD1F-120

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
  • common name:
    • gibberellin A24
  • molecular weight:
    • 344.407
  • Synonym(s):
    • GA24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-120&oldid=29665"