Difference between revisions of "CREATINE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-KINASE-RXN CREATINE-KINASE-RXN] == * direction: ** REVERSIBLE * common name: ** creatine k...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-KINASE-RXN CREATINE-KINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** creatine kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.3.2 EC-2.7.3.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[CREATINE]][c] '''<=>''' 1 [[CREATINE-P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 creatine[c] '''<=>''' 1 creatine-phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-14_002050]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6158]], creatine-phosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6158 PWY-6158] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17157 17157] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01881 R01881] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P07310 P07310] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P05123 P05123] |
− | * | + | ** [http://www.uniprot.org/uniprot/P05122 P05122] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P11009 P11009] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12532 P12532] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P16641 P16641] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P17540 P17540] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LZG7 Q7LZG7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q04447 Q04447] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18294 P18294] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PSI5 Q9PSI5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LZG6 Q7LZG6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7LZG8 Q7LZG8] |
+ | ** [http://www.uniprot.org/uniprot/Q7M337 Q7M337] | ||
+ | ** [http://www.uniprot.org/uniprot/P05124 P05124] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PSI4 Q9PSI4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M336 Q7M336] | ||
+ | ** [http://www.uniprot.org/uniprot/P00565 P00565] | ||
+ | ** [http://www.uniprot.org/uniprot/P12277 P12277] | ||
+ | ** [http://www.uniprot.org/uniprot/P06732 P06732] | ||
+ | ** [http://www.uniprot.org/uniprot/P00567 P00567] | ||
+ | ** [http://www.uniprot.org/uniprot/P00563 P00563] | ||
+ | ** [http://www.uniprot.org/uniprot/P07335 P07335] | ||
+ | ** [http://www.uniprot.org/uniprot/P00564 P00564] | ||
+ | ** [http://www.uniprot.org/uniprot/P00566 P00566] | ||
+ | ** [http://www.uniprot.org/uniprot/P04414 P04414] | ||
+ | ** [http://www.uniprot.org/uniprot/P24722 P24722] | ||
+ | ** [http://www.uniprot.org/uniprot/P09605 P09605] | ||
+ | ** [http://www.uniprot.org/uniprot/P25809 P25809] | ||
+ | ** [http://www.uniprot.org/uniprot/P30275 P30275] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=creatine kinase}} | ||
+ | {{#set: ec number=EC-2.7.3.2}} | ||
+ | {{#set: gene associated=Ec-14_002050}} | ||
+ | {{#set: in pathway=PWY-6158}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction CREATINE-KINASE-RXN
- direction:
- REVERSIBLE
- common name:
- creatine kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 CREATINE[c] <=> 1 CREATINE-P[c] + 1 PROTON[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 creatine[c] <=> 1 creatine-phosphate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-14_002050
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6158, creatine-phosphate biosynthesis: PWY-6158
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: