Difference between revisions of "CPD-14901"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATEREDUCT-RXN DIHYDROFOLATEREDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATEREDUCT-RXN DIHYDROFOLATEREDUCT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
 
* common name:
 
* common name:
−
** Tetrahydrofolate dehydrogenase/cyclohydrolase
+
** poriferst-7-enol
−
** Tetrahydrofolate dehydrogenase/cyclohydrolase, catalytic domain
+
* molecular weight:
−
** dihydrofolate reductase
+
** 414.713   
−
** Tetrahydrofolate dehydrogenase/cyclohydrolase, NAD(P)-binding domain
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.5.1.3 EC-1.5.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 22-dihydrochondrillasterol
 +
** 24β-ethylcholest-7-en-3β-ol
 +
** chondrillast-7-enol
 +
** dihydrochondrillasterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13892]]
−
** 1 [[DIHYDROFOLATE-GLU-N]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[THF-GLU-N]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 7,8-dihydrofolate[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 a tetrahydrofolate[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-07_007470]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-27_004630]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-15_001370]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-14_004070]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-6614]], tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 18525-35-4
−
** [http://www.genome.jp/dbget-bin/www_bget?R00939 R00939]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364]
−
{{#set: common name=Tetrahydrofolate dehydrogenase/cyclohydrolase}}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: common name=Tetrahydrofolate dehydrogenase/cyclohydrolase, catalytic domain}}
+
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
−
{{#set: common name=dihydrofolate reductase}}
+
{{#set: common name=poriferst-7-enol}}
−
{{#set: common name=Tetrahydrofolate dehydrogenase/cyclohydrolase, NAD(P)-binding domain}}
+
{{#set: molecular weight=414.713    }}
−
{{#set: ec number=EC-1.5.1.3}}
+
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
−
{{#set: gene associated=Ec-07_007470|Ec-27_004630|Ec-15_001370|Ec-14_004070}}
+
{{#set: consumed by=RXN-13892}}
−
{{#set: in pathway=1CMET2-PWY|PWY-6614|PWY-3841}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite CPD-14901

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
  • common name:
    • poriferst-7-enol
  • molecular weight:
    • 414.713
  • Synonym(s):
    • 22-dihydrochondrillasterol
    • 24β-ethylcholest-7-en-3β-ol
    • chondrillast-7-enol
    • dihydrochondrillasterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-14901&oldid=29693"