Difference between revisions of "Ec-05 004840"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(Created page with "Category:Gene == Gene Ec-05_004840 == * left end position: ** 6853753 * transcription direction: ** NEGATIVE * right end position: ** 6856507 * centisome position: ** 75.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
+
== Gene Ec-05_004840 ==
−
* smiles:
+
* left end position:
−
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 6853753
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** poriferst-7-enol
+
** 6856507
−
* molecular weight:
+
* centisome position:
−
** 414.713    
+
** 75.28698    
 
* Synonym(s):
 
* Synonym(s):
−
** 22-dihydrochondrillasterol
+
** Esi_0229_0027
−
** 24β-ethylcholest-7-en-3β-ol
+
** Esi0229_0027
−
** chondrillast-7-enol
+
−
** dihydrochondrillasterol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13892]]
+
* Reaction: [[DISULFOXRED-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 18525-35-4
+
{{#set: left end position=6853753}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364]
+
{{#set: right end position=6856507}}
−
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: centisome position=75.28698   }}
−
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
+
{{#set: common name=Esi_0229_0027|Esi0229_0027}}
−
{{#set: common name=poriferst-7-enol}}
+
{{#set: reaction associated=DISULFOXRED-RXN}}
−
{{#set: molecular weight=414.713   }}
+
−
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
+
−
{{#set: consumed by=RXN-13892}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-05_004840

  • left end position:
    • 6853753
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6856507
  • centisome position:
    • 75.28698
  • Synonym(s):
    • Esi_0229_0027
    • Esi0229_0027

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_004840&oldid=29705"