Difference between revisions of "CPD1F-134"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTRNAREDUCT-RXN GLUTRNAREDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glutamyl-tR...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTRNAREDUCT-RXN GLUTRNAREDUCT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
 
* common name:
 
* common name:
−
** Glutamyl-tRNA Reductase, chloroplast precursor
+
** gibberellin A9
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.70 EC-1.2.1.70]
+
** 315.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** C19-GAs
 +
** closed lactone gibberellin skeleton
 +
** C19 skeleton
 +
** C19-GA skeleton
 +
** C19-gibberellin skeleton
 +
** GA9
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-165]]
−
** 1 [[Charged-GLT-tRNAs]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[GLUTAMATE-1-SEMIALDEHYDE]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[GLT-tRNAs]][c]
+
* [[RXN-171]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 an L-glutamyl-[tRNAGlu][c] '''+''' 1 NADPH[c] '''=>''' 1 (S)-4-amino-5-oxopentanoate[c] '''+''' 1 NADP+[c] '''+''' 1 a tRNAglu[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_000430]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5188]], tetrapyrrole biosynthesis I (from glutamate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5188 PWY-5188]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12344 12344]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04109 R04109]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=Glutamyl-tRNA Reductase, chloroplast precursor}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
−
{{#set: ec number=EC-1.2.1.70}}
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
−
{{#set: gene associated=Ec-01_000430}}
+
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
−
{{#set: in pathway=PWY-5188}}
+
{{#set: common name=gibberellin A9}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=315.388    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: consumed by=RXN1F-165|RXN-171}}

Latest revision as of 20:50, 21 March 2018

Metabolite CPD1F-134

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
  • common name:
    • gibberellin A9
  • molecular weight:
    • 315.388
  • Synonym(s):
    • C19-GAs
    • closed lactone gibberellin skeleton
    • C19 skeleton
    • C19-GA skeleton
    • C19-gibberellin skeleton
    • GA9

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-134&oldid=29707"