Difference between revisions of "OROTATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_004370 == * left end position: ** 4080022 * transcription direction: ** NEGATIVE * right end position: ** 4087172 * centisome position: ** 60.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** orotate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 155.09 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** orotic acid |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-6490]] |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN0-6491]] |
| − | == | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[RXN0-6554]] |
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[OROPRIBTRANS-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 65-86-1 |
| − | {{#set: | + | * BIGG : 34527 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348] |
| − | {{#set: common name= | + | * HMDB : HMDB00226 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839] | ||
| + | * METABOLIGHTS : MTBLC30839 | ||
| + | {{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}} | ||
| + | {{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=orotate}} | ||
| + | {{#set: molecular weight=155.09 }} | ||
| + | {{#set: common name=orotic acid}} | ||
| + | {{#set: consumed by=RXN0-6490}} | ||
| + | {{#set: produced by=RXN0-6491|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6554}} | ||
| + | {{#set: reversible reaction associated=OROPRIBTRANS-RXN}} | ||
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite OROTATE
- smiles:
- C1(=C(C([O-])=O)NC(NC(=O)1)=O)
- inchi key:
- InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
- common name:
- orotate
- molecular weight:
- 155.09
- Synonym(s):
- orotic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 65-86-1
- BIGG : 34527
- PUBCHEM:
- HMDB : HMDB00226
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC30839
"C1(=C(C([O-])=O)NC(NC(=O)1)=O)" cannot be used as a page name in this wiki.
