Difference between revisions of "3-Methyl-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acyl-CoA 3-Methyl-Saturated-Fatty-Acyl-CoA] == * common name: ** a 3-m...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acyl-CoA 3-Methyl-Saturated-Fatty-Acyl-CoA] ==
−
* smiles:
+
−
** C1(=C(C([O-])=O)NC(NC(=O)1)=O)
+
−
* inchi key:
+
−
** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** orotate
+
** a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA
−
* molecular weight:
+
−
** 155.09   
+
 
* Synonym(s):
 
* Synonym(s):
−
** orotic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-6490]]
+
* [[RXN66-470]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-6491]]
+
* [[RXN66-469]]
−
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
−
* [[RXN0-6554]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[OROPRIBTRANS-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 65-86-1
+
{{#set: common name=a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA}}
−
* BIGG : 34527
+
{{#set: consumed by=RXN66-470}}
−
* PUBCHEM:
+
{{#set: produced by=RXN66-469}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348]
+
−
* HMDB : HMDB00226
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839]
+
−
* METABOLIGHTS : MTBLC30839
+
−
{{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}}
+
−
{{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}}
+
−
{{#set: common name=orotate}}
+
−
{{#set: molecular weight=155.09    }}
+
−
{{#set: common name=orotic acid}}
+
−
{{#set: consumed by=RXN0-6490}}
+
−
{{#set: produced by=RXN0-6491|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6554}}
+
−
{{#set: consumed or produced by=OROPRIBTRANS-RXN}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA

  • common name:
    • a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-Methyl-Saturated-Fatty-Acyl-CoA&oldid=29724"