Difference between revisions of "RXN-7790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7790 RXN-7790] == * direction: ** LEFT-TO-RIGHT * common name: ** Branched chain alpha-keto aci...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7790 RXN-7790] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Branched chain alpha-keto acid dehydrogenase E1 beta subunit |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[2 | + | * With identifiers: |
− | = | + | ** 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROPIONYL-COA]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 2-oxobutanoate[c] '''+''' 1 coenzyme A[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 propanoyl-CoA[c] '''+''' 1 CO2[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_009010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY66-428]], L-threonine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-5130]], 2-oxobutanoate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5130 PWY-5130] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33223 33223] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Branched chain alpha-keto acid dehydrogenase E1 beta subunit}} | |
− | + | {{#set: gene associated=Ec-06_009010}} | |
− | + | {{#set: in pathway=PWY66-428|PWY-5130}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | ** [http://www.ebi.ac.uk/ | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:51, 21 March 2018
Contents
Reaction RXN-7790
- direction:
- LEFT-TO-RIGHT
- common name:
- Branched chain alpha-keto acid dehydrogenase E1 beta subunit
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-OXOBUTANOATE[c] + 1 CO-A[c] + 1 NAD[c] => 1 NADH[c] + 1 PROPIONYL-COA[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 2-oxobutanoate[c] + 1 coenzyme A[c] + 1 NAD+[c] => 1 NADH[c] + 1 propanoyl-CoA[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_009010
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY66-428, L-threonine degradation V: PWY66-428
- 2 reactions found over 2 reactions in the full pathway
- PWY-5130, 2-oxobutanoate degradation I: PWY-5130
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA: