Difference between revisions of "Ec-01 005740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Gene == Gene Ec-01_005740 == * left end position: ** 4983791 * transcription direction: ** NEGATIVE * right end position: ** 4994540 * centisome position: ** 48.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_005740 == |
− | * | + | * left end position: |
− | ** | + | ** 4983791 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4994540 |
− | * | + | * centisome position: |
− | ** | + | ** 48.298004 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0392_0017 |
− | ** | + | ** Esi0392_0017 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.25.1-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4983791}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4994540}} | |
− | + | {{#set: centisome position=48.298004 }} | |
− | + | {{#set: common name=Esi_0392_0017|Esi0392_0017}} | |
− | + | {{#set: reaction associated=3.4.25.1-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:51, 21 March 2018
Gene Ec-01_005740
- left end position:
- 4983791
- transcription direction:
- NEGATIVE
- right end position:
- 4994540
- centisome position:
- 48.298004
- Synonym(s):
- Esi_0392_0017
- Esi0392_0017
Reactions associated
- Reaction: 3.4.25.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome