|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(O)C2(=NC1(C(=O)NC(N)=NC=1NC2)) |
| + | * inchi key: |
| + | ** InChIKey=CQQNNQTXUGLUEV-UHFFFAOYSA-N |
| * common name: | | * common name: |
− | ** Thiolase, C-terminal | + | ** 6-(hydroxymethyl)-7,8-dihydropterin |
− | ** Acetyl-CoA acetyltransferase | + | * molecular weight: |
− | * ec number:
| + | ** 195.18 |
− | ** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4(3H)-one |
| + | ** 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
− | ** 2 [[ACETYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[ACETOACETYL-COA]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 2 acetyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 acetoacetyl-CoA[c]
| + | * [[H2NEOPTERINALDOL-RXN]] |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-22_002850]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-26_003940]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-24_000870]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY]
| + | |
− | ** '''4''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[P163-PWY]], L-lysine fermentation to acetate and butanoate: [http://metacyc.org/META/NEW-IMAGE?object=P163-PWY P163-PWY]
| + | |
− | ** '''1''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
| + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5676]], acetyl-CoA fermentation to butanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5676 PWY-5676] | + | |
− | ** '''1''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6588]], pyruvate fermentation to acetone: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
| + | |
− | ** '''6''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-6876]], isopropanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
| + | |
− | ** '''7''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5741]], ethylmalonyl-CoA pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741]
| + | |
− | ** '''1''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY1-3]], polyhydroxybutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1-3 PWY1-3]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[ACETOACETATE-DEG-PWY]], acetoacetate degradation (to acetyl CoA): [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DEG-PWY ACETOACETATE-DEG-PWY]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
| + | |
− | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY66-368]], ketolysis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368] | + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
| + | |
− | ** '''4''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
| + | |
− | ** '''7''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * DRUGBANK : DB02119 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21036 21036] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=218 218] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00238 R00238] | + | * LIGAND-CPD: |
− | * UNIPROT: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01300 C01300] |
− | ** [http://www.uniprot.org/uniprot/Q8CAY6 Q8CAY6] | + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P41338 P41338]
| + | ** [http://www.chemspider.com/Chemical-Structure.213.html 213] |
− | ** [http://www.uniprot.org/uniprot/P45362 P45362] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q9BWD1 Q9BWD1] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=44841 44841] |
− | ** [http://www.uniprot.org/uniprot/P45359 P45359]
| + | * BIGG : 1447073 |
− | ** [http://www.uniprot.org/uniprot/P24752 P24752]
| + | {{#set: smiles=C(O)C2(=NC1(C(=O)NC(N)=NC=1NC2))}} |
− | ** [http://www.uniprot.org/uniprot/Q12598 Q12598] | + | {{#set: inchi key=InChIKey=CQQNNQTXUGLUEV-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P45369 P45369]
| + | {{#set: common name=6-(hydroxymethyl)-7,8-dihydropterin}} |
− | ** [http://www.uniprot.org/uniprot/P46707 P46707]
| + | {{#set: molecular weight=195.18 }} |
− | ** [http://www.uniprot.org/uniprot/P73825 P73825]
| + | {{#set: common name=2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4(3H)-one|2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one}} |
− | ** [http://www.uniprot.org/uniprot/Q43637 Q43637]
| + | {{#set: consumed by=H2PTERIDINEPYROPHOSPHOKIN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9UQW6 Q9UQW6]
| + | {{#set: reversible reaction associated=H2NEOPTERINALDOL-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9Z3Y4 Q9Z3Y4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77852 P77852]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XD81 Q9XD81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZGI9 Q9ZGI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9L8E0 Q9L8E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14611 P14611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07097 P07097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17764 P17764]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Thiolase, C-terminal}} | + | |
− | {{#set: common name=Acetyl-CoA acetyltransferase}} | + | |
− | {{#set: ec number=EC-2.3.1.9}} | + | |
− | {{#set: gene associated=Ec-22_002850|Ec-26_003940|Ec-24_000870}} | + | |
− | {{#set: in pathway=P162-PWY|PWY-5177|PWY-6583|P163-PWY|PWY-6883|PWY-5676|PWY-7778|PWY-7779|PWY-6588|PWY-6174|PWY-5789|PWY-6876|CENTFERM-PWY|PWY-7391|PWY-5741|PWY1-3|ACETOACETATE-DEG-PWY|PWY66-367|PWY-7216|PWY-922|PWY66-368|PWY-7401|PWY-6863|PWY-7524}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=aragem}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |