Difference between revisions of "QUEUINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141] == * direction: ** LEFT-TO-RIGHT * common name: ** GDP-L-galactose/GDP-D-glu...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
 +
* inchi key:
 +
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
 
* common name:
 
* common name:
−
** GDP-L-galactose/GDP-D-glucose phosphorylase
+
** queuine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.7.69 EC-2.7.7.69]
+
** 278.29   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 +
** base Q
 +
** 4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[GDP-L-GALACTOSE]][c] '''+''' 1 [[Pi]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPDQT-4]][c] '''+''' 1 [[GDP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
−
** 1 GDP-β-L-galactose[c] '''+''' 1 phosphate[c] '''=>''' 1 H+[c] '''+''' 1 β-L-galactose 1-phosphate[c] '''+''' 1 GDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-15_001960]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
+
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27698 27698]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07678 R07678]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB01495
−
{{#set: common name=GDP-L-galactose/GDP-D-glucose phosphorylase}}
+
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
−
{{#set: ec number=EC-2.7.7.69}}
+
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
−
{{#set: gene associated=Ec-15_001960}}
+
{{#set: common name=queuine}}
−
{{#set: in pathway=PWY-882}}
+
{{#set: molecular weight=278.29    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q|4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:51, 21 March 2018

Metabolite QUEUINE

  • smiles:
    • C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
  • inchi key:
    • InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
  • common name:
    • queuine
  • molecular weight:
    • 278.29
  • Synonym(s):
    • 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
    • base Q
    • 4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=QUEUINE&oldid=29795"