Difference between revisions of "RXN-12561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] == * direction: ** REVERSIBLE * common name: ** Thiolase, C-terminal ** Acetyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] ==
−
* smiles:
+
* direction:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
 
* common name:
 
* common name:
−
** queuine
+
** Thiolase, C-terminal
−
* molecular weight:
+
** Acetyl-CoA acetyltransferase
−
** 278.29   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
−
** base Q
 
−
** 4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[PROPIONYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-13534]][c]
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 1 propanoyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 &beta;-ketovaleryl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_000870]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_002850]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: common name=Thiolase, C-terminal}}
−
* CHEBI:
+
{{#set: common name=Acetyl-CoA acetyltransferase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: ec number=EC-2.3.1.9}}
−
* HMDB : HMDB01495
+
{{#set: gene associated=Ec-24_000870|Ec-22_002850}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=queuine}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=278.29    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q|4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-}}
+
−
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 19:51, 21 March 2018

Reaction RXN-12561

  • direction:
    • REVERSIBLE
  • common name:
    • Thiolase, C-terminal
    • Acetyl-CoA acetyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetyl-CoA[c] + 1 propanoyl-CoA[c] <=> 1 coenzyme A[c] + 1 β-ketovaleryl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12561&oldid=29796"