Difference between revisions of "1.5.1.9-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.9-RXN 1.5.1.9-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Saccharopine dehydrogen...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.9-RXN 1.5.1.9-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Saccharopine dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.5.1.9 EC-1.5.1.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[SACCHAROPINE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[ALLYSINE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLT]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 L-saccharopine[c] '''+''' 1 NAD+[c] '''=>''' 1 (S)-2-amino-6-oxohexanoate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 L-glutamate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-07_005660]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[LYSINE-DEG1-PWY]], L-lysine degradation XI (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-DEG1-PWY LYSINE-DEG1-PWY] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24520 24520] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02313 R02313] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Saccharopine dehydrogenase}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-1.5.1.9}} |
− | * LIGAND- | + | {{#set: gene associated=Ec-07_005660}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=LYSINE-DEG1-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction 1.5.1.9-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Saccharopine dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 L-saccharopine[c] + 1 NAD+[c] => 1 (S)-2-amino-6-oxohexanoate[c] + 1 NADH[c] + 1 H+[c] + 1 L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-07_005660
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- LYSINE-DEG1-PWY, L-lysine degradation XI (mammalian): LYSINE-DEG1-PWY
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links