Difference between revisions of "Ec-11 006270"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene Ec-11_006270 == * left end position: ** 6206323 * transcription direction: ** NEGATIVE * right end position: ** 6213314 * centisome position: ** 98.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_006270 == |
− | * | + | * left end position: |
− | ** | + | ** 6206323 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6213314 |
− | * | + | * centisome position: |
− | ** | + | ** 98.67505 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0031_0156 |
+ | ** Esi0031_0156 | ||
+ | ** HSK | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[HOMOSERKIN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
+ | * [[PWY-702]] | ||
+ | * [[HOMOSER-THRESYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6206323}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6213314}} | |
− | + | {{#set: centisome position=98.67505 }} | |
− | + | {{#set: common name=Esi_0031_0156|Esi0031_0156|HSK}} | |
− | + | {{#set: reaction associated=HOMOSERKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-702|HOMOSER-THRESYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:51, 21 March 2018
Gene Ec-11_006270
- left end position:
- 6206323
- transcription direction:
- NEGATIVE
- right end position:
- 6213314
- centisome position:
- 98.67505
- Synonym(s):
- Esi_0031_0156
- Esi0031_0156
- HSK
Reactions associated
- Reaction: HOMOSERKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome