Difference between revisions of "ERYTHROSE-4P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] == * direction: ** REVERSIBLE * common name: ** Thiolase, C-terminal ** Acetyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * smiles: ** [CH](C(C(COP([O-])([O-])=O)O)O)=O * inchi key: ** In...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](C(C(COP([O-])([O-])=O)O)O)=O |
+ | * inchi key: | ||
+ | ** InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** D-erythrose 4-phosphate |
− | + | * molecular weight: | |
− | * | + | ** 198.069 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** erythrose-4P | ||
+ | ** threose 4-phosphate | ||
+ | ** erythrose-4-phosphate | ||
+ | ** erythrose-4-P | ||
+ | ** D-erythrose-4-P | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2TRANSKETO-RXN]] | |
− | + | * [[SEDOBISALDOL-RXN]] | |
− | + | * [[DAHPSYN-RXN]] | |
− | == | + | * [[TRANSALDOL-RXN]] |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 585-18-2 | |
− | + | * BIGG : 34479 | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459862 5459862] |
− | {{#set: | + | * HMDB : HMDB01321 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00279 C00279] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573609.html 4573609] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16897 16897] | ||
+ | * METABOLIGHTS : MTBLC16897 | ||
+ | {{#set: smiles=[CH](C(C(COP([O-])([O-])=O)O)O)=O}} | ||
+ | {{#set: inchi key=InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L}} | ||
+ | {{#set: common name=D-erythrose 4-phosphate}} | ||
+ | {{#set: molecular weight=198.069 }} | ||
+ | {{#set: common name=erythrose-4P|threose 4-phosphate|erythrose-4-phosphate|erythrose-4-P|D-erythrose-4-P}} | ||
+ | {{#set: reversible reaction associated=2TRANSKETO-RXN|SEDOBISALDOL-RXN|DAHPSYN-RXN|TRANSALDOL-RXN}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite ERYTHROSE-4P
- smiles:
- [CH](C(C(COP([O-])([O-])=O)O)O)=O
- inchi key:
- InChIKey=NGHMDNPXVRFFGS-IUYQGCFVSA-L
- common name:
- D-erythrose 4-phosphate
- molecular weight:
- 198.069
- Synonym(s):
- erythrose-4P
- threose 4-phosphate
- erythrose-4-phosphate
- erythrose-4-P
- D-erythrose-4-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 585-18-2
- BIGG : 34479
- PUBCHEM:
- HMDB : HMDB01321
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16897
"CH](C(C(COP([O-])([O-])=O)O)O)=O" cannot be used as a page name in this wiki.