Difference between revisions of "CPD-9612"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(=C(SC)C(=O)C1(=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(=C(SC)C(=O)C1(=C(SC=C1)C(=O)2)) |
− | ** | + | * inchi key: |
+ | ** InChIKey=GHRWXPXOBGRSHG-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** caldariellaquinone |
+ | * molecular weight: | ||
+ | ** 631.069 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-(3,7,11,15,19,23-hexamethyltetracosyl)-5-(methylsulfanyl)-1-benzothiophene-4,7-dione |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14451]] | |
− | + | * [[RXN-15378]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20624 C20624] |
− | * | + | * CHEMSPIDER: |
− | ** [http:// | + | ** [http://www.chemspider.com/Chemical-Structure.168476.html 168476] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73387 73387] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC73387 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=194166 194166] |
− | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(=C(SC)C(=O)C1(=C(SC=C1)C(=O)2))}} |
+ | {{#set: inchi key=InChIKey=GHRWXPXOBGRSHG-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=caldariellaquinone}} | ||
+ | {{#set: molecular weight=631.069 }} | ||
+ | {{#set: common name=6-(3,7,11,15,19,23-hexamethyltetracosyl)-5-(methylsulfanyl)-1-benzothiophene-4,7-dione}} | ||
+ | {{#set: consumed by=RXN-14451|RXN-15378}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite CPD-9612
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(=C(SC)C(=O)C1(=C(SC=C1)C(=O)2))
- inchi key:
- InChIKey=GHRWXPXOBGRSHG-UHFFFAOYSA-N
- common name:
- caldariellaquinone
- molecular weight:
- 631.069
- Synonym(s):
- 6-(3,7,11,15,19,23-hexamethyltetracosyl)-5-(methylsulfanyl)-1-benzothiophene-4,7-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links