Difference between revisions of "RXN-10696"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * smiles: ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] * inchi...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10696 RXN-10696] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl-CoA oxidase/dehydrogen...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10696 RXN-10696] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J
+
 
* common name:
 
* common name:
−
** β-D-fructose 2,6-bisphosphate
+
** Acyl-CoA oxidase/dehydrogenase, central domain
−
* molecular weight:
+
** acyl-CoA oxidase, partial
−
** 336.085   
+
** acyl-CoA oxidase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** fru 2,6-P2
 
−
** fructose 2,6-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[3.1.3.46-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-11517]][c] '''=>''' 1 [[CPD-11518]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA[c] '''=>''' 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''10''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21117974 21117974]
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
* HMDB : HMDB01047
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-CoA oxidase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00665 C00665]
+
{{#set: ec number=EC-1.3.3.6}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-22_002920|Ec-26_004320|Ec-08_006390}}
−
** [http://www.chemspider.com/Chemical-Structure.19975981.html 19975981]
+
{{#set: in pathway=PWY-735}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58579 58579]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC58579
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J}}
+
−
{{#set: common name=β-D-fructose 2,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085    }}
+
−
{{#set: common name=fru 2,6-P2|fructose 2,6-diphosphate}}
+
−
{{#set: consumed by=3.1.3.46-RXN}}
+
−
{{#set: produced by=6-PHOSPHOFRUCTO-2-KINASE-RXN}}
+

Latest revision as of 19:51, 21 March 2018

Reaction RXN-10696

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acyl-CoA oxidase/dehydrogenase, central domain
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 oxygen[c] + 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA[c] => 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA[c] + 1 hydrogen peroxide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 10 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10696&oldid=29840"