Difference between revisions of "CPD-178"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * smiles: ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F |
* common name: | * common name: | ||
| − | ** | + | ** D-myo-inositol (3,4,5,6)-tetrakisphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 492.013 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Ins(3,4,5,6)P4 | ||
| + | ** Inositol 3,4,5,6-tetrakisphosphate | ||
| + | ** 1D-myo-inositol 3,4,5,6-tetrakisphosphate | ||
| + | ** I(3,4,5,6)P4 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.1.134-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10955]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04520 C04520] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57539 57539] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC57539 |
| − | {{#set: molecular weight= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201333 25201333] |
| − | {{#set: produced by=RXN- | + | * HMDB : HMDB03848 |
| + | {{#set: smiles=C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
| + | {{#set: inchi key=InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F}} | ||
| + | {{#set: common name=D-myo-inositol (3,4,5,6)-tetrakisphosphate}} | ||
| + | {{#set: molecular weight=492.013 }} | ||
| + | {{#set: common name=Ins(3,4,5,6)P4|Inositol 3,4,5,6-tetrakisphosphate|1D-myo-inositol 3,4,5,6-tetrakisphosphate|I(3,4,5,6)P4}} | ||
| + | {{#set: consumed by=2.7.1.134-RXN}} | ||
| + | {{#set: produced by=RXN-10955}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD-178
- smiles:
- C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- inchi key:
- InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F
- common name:
- D-myo-inositol (3,4,5,6)-tetrakisphosphate
- molecular weight:
- 492.013
- Synonym(s):
- Ins(3,4,5,6)P4
- Inositol 3,4,5,6-tetrakisphosphate
- 1D-myo-inositol 3,4,5,6-tetrakisphosphate
- I(3,4,5,6)P4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.
