Difference between revisions of "DGDP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_001350 == * left end position: ** 1302781 * transcription direction: ** POSITIVE * right end position: ** 1317744 * centisome position: ** 26.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K |
− | * | + | * common name: |
− | ** | + | ** dGDP |
− | * | + | * molecular weight: |
− | ** | + | ** 424.18 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxyguanosine-5'-diphosphate |
− | ** | + | ** deoxyguanosine-diphosphate |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN | + | * [[DGDPKIN-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-748]] | |
− | + | * [[RXN-14217]] | |
− | + | * [[GDPREDUCT-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14207]] | |
− | + | * [[RXN-14218]] | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 102783-74-4 |
− | {{#set: | + | * BIGG : 34741 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245673 25245673] |
− | {{#set: common name= | + | * HMDB : HMDB00960 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00361 C00361] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58595 58595] | ||
+ | * METABOLIGHTS : MTBLC58595 | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K}} | ||
+ | {{#set: common name=dGDP}} | ||
+ | {{#set: molecular weight=424.18 }} | ||
+ | {{#set: common name=2'-deoxyguanosine-5'-diphosphate|deoxyguanosine-diphosphate}} | ||
+ | {{#set: consumed by=DGDPKIN-RXN}} | ||
+ | {{#set: produced by=RXN0-748|RXN-14217|GDPREDUCT-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14207|RXN-14218}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite DGDP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K
- common name:
- dGDP
- molecular weight:
- 424.18
- Synonym(s):
- 2'-deoxyguanosine-5'-diphosphate
- deoxyguanosine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 102783-74-4
- BIGG : 34741
- PUBCHEM:
- HMDB : HMDB00960
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58595
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.