Difference between revisions of "CPD1F-96"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-17_003830 == * left end position: ** 4050964 * transcription direction: ** NEGATIVE * right end position: ** 4052249 * centisome position: ** 84.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L |
| − | * | + | * common name: |
| − | ** | + | ** gibberellin A19 |
| − | * | + | * molecular weight: |
| − | ** | + | ** 360.406 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** GA19 |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN1F-168]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034] | |
| − | {{#set: | + | * HMDB : HMDB36896 |
| + | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
| + | {{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}} | ||
| + | {{#set: common name=gibberellin A19}} | ||
| + | {{#set: molecular weight=360.406 }} | ||
| + | {{#set: common name=GA19}} | ||
| + | {{#set: produced by=RXN1F-168}} | ||
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD1F-96
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
- common name:
- gibberellin A19
- molecular weight:
- 360.406
- Synonym(s):
- GA19
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.
