Difference between revisions of "Ec-14 001310"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
 
(Created page with "Category:Gene == Gene Ec-14_001310 == * left end position: ** 1295374 * transcription direction: ** POSITIVE * right end position: ** 1313684 * centisome position: ** 19.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
+
== Gene Ec-14_001310 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 1295374
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ITP
+
** 1313684
−
* molecular weight:
+
* centisome position:
−
** 504.137    
+
** 19.745266    
 
* Synonym(s):
 
* Synonym(s):
−
** inosine triphosphate
+
** Esi_0182_0049
 +
** Esi0182_0049
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5073]]
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
* [[RXN0-6382]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[RXN-14120]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 132-06-9
+
{{#set: left end position=1295374}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439]
+
{{#set: right end position=1313684}}
−
* HMDB : HMDB00189
+
{{#set: centisome position=19.745266   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0182_0049|Esi0182_0049}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081]
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402]
+
−
* BIGG : 33780
+
−
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}}
+
−
{{#set: common name=ITP}}
+
−
{{#set: molecular weight=504.137   }}
+
−
{{#set: common name=inosine triphosphate}}
+
−
{{#set: consumed by=RXN0-5073|RXN0-6382}}
+
−
{{#set: consumed or produced by=RXN-14120}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-14_001310

  • left end position:
    • 1295374
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1313684
  • centisome position:
    • 19.745266
  • Synonym(s):
    • Esi_0182_0049
    • Esi0182_0049

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_001310&oldid=29872"