Difference between revisions of "ITP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXKIN-RXN PYRIDOXKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine kina...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXKIN-RXN PYRIDOXKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
 +
* inchi key:
 +
** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
 
* common name:
 
* common name:
−
** Pyridoxamine kinase
+
** ITP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.35 EC-2.7.1.35]
+
** 504.137   
 
* Synonym(s):
 
* Synonym(s):
 +
** inosine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-5073]]
−
** 1 [[PYRIDOXAL]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c] '''+''' 1 [[ADP]][c]
+
* [[RXN0-6382]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 pyridoxal[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 pyridoxal 5'-phosphate[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-14120]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_001230]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 132-06-9
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10224 10224]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00174 R00174]
+
* HMDB : HMDB00189
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q7M2L1 Q7M2L1]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081]
−
** [http://www.uniprot.org/uniprot/P44690 P44690]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P77150 P77150]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : 33780
−
{{#set: common name=Pyridoxamine kinase}}
+
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
−
{{#set: ec number=EC-2.7.1.35}}
+
{{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}}
−
{{#set: gene associated=Ec-02_001230}}
+
{{#set: common name=ITP}}
−
{{#set: in pathway=PWY-7204|PWY-7282|PLPSAL-PWY}}
+
{{#set: molecular weight=504.137    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=inosine triphosphate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN0-5073|RXN0-6382}}
−
{{#set: reconstruction source=aragem}}
+
{{#set: reversible reaction associated=RXN-14120}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 20:52, 21 March 2018

Metabolite ITP

  • smiles:
    • C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • inchi key:
    • InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
  • common name:
    • ITP
  • molecular weight:
    • 504.137
  • Synonym(s):
    • inosine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 132-06-9
  • PUBCHEM:
  • HMDB : HMDB00189
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : 33780
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ITP&oldid=29875"