Difference between revisions of "O-UREIDOHOMOSERINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyltr...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC(C(=O)[O-])[N+])ONC(N)=O
 +
* inchi key:
 +
** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
 
* common name:
 
* common name:
−
** Glycerol-3-phosphate O-acyltransferase
+
** O-ureidohomoserine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
+
** 177.16   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10]]
−
** 1 [[Long-Chain-Acyl-CoAs]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[ACYL-SN-GLYCEROL-3P]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-9]]
−
** 1 a long-chain acyl-CoA[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a 1-acyl-sn-glycerol 3-phosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003960]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5667]], CDP-diacylglycerol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15325 15325]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483]
−
* LIGAND-RXN:
+
* HMDB : HMDB12271
−
** [http://www.genome.jp/dbget-bin/www_bget?R00851 R00851]
+
{{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}}
−
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
+
{{#set: common name=O-ureidohomoserine}}
−
{{#set: ec number=EC-2.3.1.15}}
+
{{#set: molecular weight=177.16    }}
−
{{#set: gene associated=Ec-01_003960}}
+
{{#set: consumed by=RXN-10}}
−
{{#set: in pathway=PWY-5667|TRIGLSYN-PWY}}
+
{{#set: produced by=RXN-9}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 20:52, 21 March 2018

Metabolite O-UREIDOHOMOSERINE

  • smiles:
    • C(CC(C(=O)[O-])[N+])ONC(N)=O
  • inchi key:
    • InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
  • common name:
    • O-ureidohomoserine
  • molecular weight:
    • 177.16
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC(C(=O)[O-])[N+])ONC(N)=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=O-UREIDOHOMOSERINE&oldid=29887"