Difference between revisions of "O-UREIDOHOMOSERINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyltr...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC(C(=O)[O-])[N+])ONC(N)=O |
+ | * inchi key: | ||
+ | ** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** O-ureidohomoserine |
− | * | + | * molecular weight: |
− | ** | + | ** 177.16 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483] |
− | * | + | * HMDB : HMDB12271 |
− | + | {{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}} |
− | + | {{#set: common name=O-ureidohomoserine}} | |
− | + | {{#set: molecular weight=177.16 }} | |
− | {{#set: | + | {{#set: consumed by=RXN-10}} |
− | {{#set: | + | {{#set: produced by=RXN-9}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:52, 21 March 2018
Contents
Metabolite O-UREIDOHOMOSERINE
- smiles:
- C(CC(C(=O)[O-])[N+])ONC(N)=O
- inchi key:
- InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
- common name:
- O-ureidohomoserine
- molecular weight:
- 177.16
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12271
"C(CC(C(=O)[O-])[N+])ONC(N)=O" cannot be used as a page name in this wiki.