Difference between revisions of "CPD-696"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14272 RXN-14272] == * direction: ** LEFT-TO-RIGHT * common name: ** (E)-hexadec-2-enoyl-CoA hyd...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14272 RXN-14272] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
 +
* inchi key:
 +
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
 
* common name:
 
* common name:
−
** (E)-hexadec-2-enoyl-CoA hydratase
+
** 24-methylenecycloartanol
−
** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
+
* molecular weight:
−
** ClpP/crotonase-like domain
+
** 440.751   
−
** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 24(28)-methylenecycloartanol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[CPD0-2117]][c] '''=>''' 1 [[CPD0-2232]][c]
+
* [[RXN-4021]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 trans-hexadec-2-enoyl-CoA[c] '''=>''' 1 (S)-3-hydroxyhexadecanoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_006530]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-16_001250]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-06_001380]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-16_003560]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
+
−
** '''5''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
+
−
** '''4''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31165 31165]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658794 90658794]
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04738 R04738]
+
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
−
{{#set: common name=(E)-hexadec-2-enoyl-CoA hydratase}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
−
{{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}}
+
{{#set: common name=24-methylenecycloartanol}}
−
{{#set: common name=ClpP/crotonase-like domain}}
+
{{#set: molecular weight=440.751    }}
−
{{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
+
{{#set: common name=24(28)-methylenecycloartanol}}
−
{{#set: ec number=EC-4.2.1.17}}
+
{{#set: produced by=RXN-4021}}
−
{{#set: gene associated=Ec-14_006530|Ec-16_001250|Ec-06_001380|Ec-16_003560}}
+
−
{{#set: in pathway=PWY-7654|PWY-7656}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 20:52, 21 March 2018

Metabolite CPD-696

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
  • common name:
    • 24-methylenecycloartanol
  • molecular weight:
    • 440.751
  • Synonym(s):
    • 24(28)-methylenecycloartanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-696&oldid=29927"