Difference between revisions of "CPD-3762"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxal phosphate-depende...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == * smiles: ** C1(=NC(C(N)=O)C(N)=N1) * inchi key: ** InChIKey=PYNDTGFTPOZG...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=NC(C(N)=O)C(N)=N1)
 +
* inchi key:
 +
** InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** Pyridoxal phosphate-dependent transferase, major region, subdomain 1
+
** 5-amino-4-imidazolecarboxyamide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.4.1.1 EC-4.4.1.1]
+
** 126.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1H-imidazole-4-carboxamide, 5-amino-
 +
** 5(4)-amino-4(5)-imidazolecarboxamide
 +
** 5-aminoimidazole-4-carboxamide
 +
** 4-amino-5-carbamoylimidazole
 +
** 4-amino-5-imidazolecarboxamide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-CYSTATHIONINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14270]]
−
** 1 L-cystathionine[c] '''+''' 1 H2O[c] '''=>''' 1 L-cysteine[c] '''+''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-12_003100]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01001 R01001]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04051 C04051]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P21357 P21357]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030]
−
** [http://www.uniprot.org/uniprot/P18757 P18757]
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P32929 P32929]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832]
−
** [http://www.uniprot.org/uniprot/P31373 P31373]
+
* HMDB : HMDB03192
−
** [http://www.uniprot.org/uniprot/Q47847 Q47847]
+
{{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N}}
−
{{#set: common name=Pyridoxal phosphate-dependent transferase, major region, subdomain 1}}
+
{{#set: common name=5-amino-4-imidazolecarboxyamide}}
−
{{#set: ec number=EC-4.4.1.1}}
+
{{#set: molecular weight=126.118    }}
−
{{#set: gene associated=Ec-12_003100}}
+
{{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}}
−
{{#set: in pathway=}}
+
{{#set: reversible reaction associated=RXN-14270}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite CPD-3762

  • smiles:
    • C1(=NC(C(N)=O)C(N)=N1)
  • inchi key:
    • InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
  • common name:
    • 5-amino-4-imidazolecarboxyamide
  • molecular weight:
    • 126.118
  • Synonym(s):
    • 1H-imidazole-4-carboxamide, 5-amino-
    • 5(4)-amino-4(5)-imidazolecarboxamide
    • 5-aminoimidazole-4-carboxamide
    • 4-amino-5-carbamoylimidazole
    • 4-amino-5-imidazolecarboxamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-3762&oldid=29945"