Difference between revisions of "O-phospho-L-seryl-tRNASecs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * inchi key: ** InChIKey=SXZYCX...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] == * common name: ** an O-phospho-L-sery...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] ==
* smiles:
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
* inchi key:
+
** InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N
+
 
* common name:
 
* common name:
** L-galactono-1,4-lactone
+
** an O-phospho-L-seryl-[tRNASec]
* molecular weight:
+
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
** L-galactono-γ-lactone
+
** an O-phosphoseryl-[tRNAsec]
** L-galactonate-γ-lactone
+
** an O-phosphoseryl-tRNA[Ser]Sec
** L-galactonic acid-γ-lactone
+
** an O-phosphoseryl-[tRNA(Sec)]
** L-galactonic acid-g-lactone
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1884]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-11152]]
+
* [[RXN-10038]]
 
== External links  ==
 
== External links  ==
* CAS : 1668-08-2
+
{{#set: common name=an O-phospho-L-seryl-[tRNASec]}}
* PUBCHEM:
+
{{#set: common name=an O-phosphoseryl-[tRNAsec]|an O-phosphoseryl-tRNA[Ser]Sec|an O-phosphoseryl-[tRNA(Sec)]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857365 6857365]
+
{{#set: consumed by=RXN-10039}}
* CHEMSPIDER:
+
{{#set: reversible reaction associated=RXN-10038}}
** [http://www.chemspider.com/Chemical-Structure.388522.html 388522]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115]
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N}}
+
{{#set: common name=L-galactono-1,4-lactone}}
+
{{#set: molecular weight=178.141    }}
+
{{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}}
+
{{#set: produced by=RXN-1884}}
+
{{#set: consumed or produced by=RXN-11152}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite O-phospho-L-seryl-tRNASecs

  • common name:
    • an O-phospho-L-seryl-[tRNASec]
  • Synonym(s):
    • an O-phosphoseryl-[tRNAsec]
    • an O-phosphoseryl-tRNA[Ser]Sec
    • an O-phosphoseryl-[tRNA(Sec)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an O-phospho-L-seryl-[tRNASec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNAsec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-tRNA[Ser]Sec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNA(Sec)" cannot be used as a page name in this wiki.