Difference between revisions of "CPD-12936"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] == * direction: ** LEFT-TO-RIGHT * common name: ** Monooxygenase, FAD-binding...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
 +
* inchi key:
 +
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
 
* common name:
 
* common name:
−
** Monooxygenase, FAD-binding
+
** apo-4'-lycopenal
−
** Aromatic-ring hydroxylase-like
+
* molecular weight:
−
* ec number:
+
** 482.748   
−
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3481]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3483]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-11999]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 bupropion[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 hydroxybupropion[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-00_001320]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-26_003280]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-01_010880]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-241]], bupropion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-241 PWY66-241]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Monooxygenase, FAD-binding}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
−
{{#set: common name=Aromatic-ring hydroxylase-like}}
+
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
−
{{#set: ec number=EC-1.14.14.1}}
+
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
−
{{#set: gene associated=Ec-00_001320|Ec-26_003280|Ec-01_010880}}
+
{{#set: common name=apo-4'-lycopenal}}
−
{{#set: in pathway=PWY66-241}}
+
{{#set: molecular weight=482.748    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-11999}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 20:53, 21 March 2018

Metabolite CPD-12936

  • smiles:
    • CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
  • inchi key:
    • InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
  • common name:
    • apo-4'-lycopenal
  • molecular weight:
    • 482.748
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12936&oldid=29983"