Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SEDOBISALDOL-RXN SEDOBISALDOL-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.exp...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SEDOBISALDOL-RXN SEDOBISALDOL-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.1.2 EC-4.1.2]
+
** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
 +
* common name:
 +
** D-mannitol 1-phosphate
 +
* molecular weight:
 +
** 260.137   
 
* Synonym(s):
 
* Synonym(s):
 +
** mannitol-1-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
−
** 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[ERYTHROSE-4P]][c] '''<=>''' 1 [[D-SEDOHEPTULOSE-1-7-P2]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 glycerone phosphate[c] '''+''' 1 D-erythrose 4-phosphate[c] '''<=>''' 1 D-sedoheptulose-1,7-bisphosphate[c]
+
* [[MANNPDEHYDROG-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_004980]]
+
−
** [[pantograph]]-[[aragem]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
+
−
** '''13''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY0-1517]], sedoheptulose bisphosphate bypass: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 15806-48-1
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30167 30167]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01829 R01829]
+
* HMDB : HMDB01530
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-4.1.2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644]
−
{{#set: gene associated=Ec-10_004980}}
+
* CHEMSPIDER:
−
{{#set: in pathway=CALVIN-PWY|PWY0-1517}}
+
** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381]
−
{{#set: reconstruction source=aragem}}
+
* BIGG : 35604
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=D-mannitol 1-phosphate}}
 +
{{#set: molecular weight=260.137    }}
 +
{{#set: common name=mannitol-1-P}}
 +
{{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}}
 +
{{#set: reversible reaction associated=MANNPDEHYDROG-RXN}}

Latest revision as of 19:53, 21 March 2018

Metabolite MANNITOL-1P

  • smiles:
    • C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
  • inchi key:
    • InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
  • common name:
    • D-mannitol 1-phosphate
  • molecular weight:
    • 260.137
  • Synonym(s):
    • mannitol-1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MANNITOL-1P&oldid=29987"