Difference between revisions of "Enoylglutaryl-ACP-methyl-esters"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylglutaryl-ACP-methyl-esters Enoylglutaryl-ACP-methyl-esters] == * common name: ** an enoylg...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylglutaryl-ACP-methyl-esters Enoylglutaryl-ACP-methyl-esters] ==
* smiles:
+
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
* inchi key:
+
** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
+
 
* common name:
 
* common name:
** (3Z)-phycoerythrobilin
+
** an enoylglutaryl-[acp] methyl ester
* molecular weight:
+
** 584.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11478]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an enoylglutaryl-[acp] methyl ester}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182]
+
{{#set: consumed by=RXN-11478}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438]
+
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}}
+
{{#set: common name=(3Z)-phycoerythrobilin}}
+
{{#set: molecular weight=584.671    }}
+
{{#set: produced by=1.3.7.3-RXN}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite Enoylglutaryl-ACP-methyl-esters

  • common name:
    • an enoylglutaryl-[acp] methyl ester
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an enoylglutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.