Difference between revisions of "3Z-PHYCOERYTHROBILIN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17775 RXN-17775] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA dehydrogenase ** A...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
| + | * inchi key: | ||
| + | ** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** (3Z)-phycoerythrobilin |
| − | * | + | * molecular weight: |
| − | + | ** 584.671 | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[1.3.7.3-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438] | |
| − | {{#set: | + | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}} |
| − | {{#set: | + | {{#set: common name=(3Z)-phycoerythrobilin}} |
| − | {{#set: | + | {{#set: molecular weight=584.671 }} |
| − | {{#set: | + | {{#set: produced by=1.3.7.3-RXN}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite 3Z-PHYCOERYTHROBILIN
- smiles:
- CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- inchi key:
- InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
- common name:
- (3Z)-phycoerythrobilin
- molecular weight:
- 584.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
