Difference between revisions of "CPD-698"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.4.4-RXN 1.2.4.4-RXN] == * direction: ** REVERSIBLE * common name: ** Dehydrogenase, E1 componen...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.4.4-RXN 1.2.4.4-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
 
* common name:
 
* common name:
−
** Dehydrogenase, E1 component
+
** campest-4-en-3-one
−
** Branched chain alpha-keto acid dehydrogenase E1 beta subunit
+
* molecular weight:
−
* ec number:
+
** 398.671   
−
** [http://enzyme.expasy.org/EC/1.2.4.4 EC-1.2.4.4]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** methylcholestenone
 +
** (24R)-24-methyl-cholest-4-en-3-one
 +
** 3-dehydro-Δ4-5-campesterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-711]]
−
** 1 [[PROTON]][c] '''+''' 1 [[BCAA-dehydrogenase-lipoyl]][c] '''+''' 1 [[2-KETO-ISOVALERATE]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[BCAA-dehydrogenase-2MP-DH-lipoyl]][c]
+
* [[RXN-4231]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 H+[c] '''+''' 1 an [apo BCAA dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''+''' 1 3-methyl-2-oxobutanoate[c] '''<=>''' 1 CO2[c] '''+''' 1 an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_006360]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-06_009010]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5046]], 2-oxoisovalerate decarboxylation to isobutanoyl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5046 PWY-5046]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01701 R01701]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P21839 P21839]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
−
** [http://www.uniprot.org/uniprot/P21953 P21953]
+
* HMDB : HMDB12196
−
** [http://www.uniprot.org/uniprot/P37940 P37940]
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.uniprot.org/uniprot/Q9PK54 Q9PK54]
+
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
−
** [http://www.uniprot.org/uniprot/P37941 P37941]
+
{{#set: common name=campest-4-en-3-one}}
−
** [http://www.uniprot.org/uniprot/P11178 P11178]
+
{{#set: molecular weight=398.671    }}
−
** [http://www.uniprot.org/uniprot/P12694 P12694]
+
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-&Delta;4-5-campesterol}}
−
** [http://www.uniprot.org/uniprot/P09061 P09061]
+
{{#set: consumed by=RXN-711|RXN-4231}}
−
** [http://www.uniprot.org/uniprot/P09060 P09060]
+
−
** [http://www.uniprot.org/uniprot/P11960 P11960]
+
−
** [http://www.uniprot.org/uniprot/O84344 O84344]
+
−
** [http://www.uniprot.org/uniprot/Q9Z9E8 Q9Z9E8]
+
−
** [http://www.uniprot.org/uniprot/Q9I1M2 Q9I1M2]
+
−
** [http://www.uniprot.org/uniprot/P35738 P35738]
+
−
** [http://www.uniprot.org/uniprot/P50136 P50136]
+
−
** [http://www.uniprot.org/uniprot/O48615 O48615]
+
−
** [http://www.uniprot.org/uniprot/O03849 O03849]
+
−
** [http://www.uniprot.org/uniprot/Q53592 Q53592]
+
−
** [http://www.uniprot.org/uniprot/Q53593 Q53593]
+
−
** [http://www.uniprot.org/uniprot/O82450 O82450]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Dehydrogenase, E1 component}}
+
−
{{#set: common name=Branched chain alpha-keto acid dehydrogenase E1 beta subunit}}
+
−
{{#set: ec number=EC-1.2.4.4}}
+
−
{{#set: gene associated=Ec-10_006360|Ec-06_009010}}
+
−
{{#set: in pathway=PWY-5046}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • common name:
    • campest-4-en-3-one
  • molecular weight:
    • 398.671
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-698&oldid=30045"